C12H14FNO2S — CID 55179362
3-(2-fluorophenyl)sulfanyl-1-(3-hydroxyazetidin-1-yl)propan-1-one (PubChem CID 55179362) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-1-(3-hydroxyazetidin-1-yl)propan-1-one.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-1-(3-hydroxyazetidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 55179362 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-1-(3-hydroxyazetidin-1-yl)propan-1-one |
| SMILES | O=C(CCSc1ccccc1F)N1CC(O)C1 |
| InChI | InChI=1S/C12H14FNO2S/c13-10-3-1-2-4-11(10)17-6-5-12(16)14-7-9(15)8-14/h1-4,9,15H,5-8H2 |
| InChIKey | BJICIEGUXGMFHN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |