C9H11FN2OS — CID 43236853
3-(2-fluorophenyl)sulfanylpropanehydrazide (PubChem CID 43236853) has the molecular formula C9H11FN2OS and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanylpropanehydrazide.
| Compound Name | 3-(2-fluorophenyl)sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 43236853 |
| Molecular Formula | C9H11FN2OS |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanylpropanehydrazide |
| SMILES | NNC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C9H11FN2OS/c10-7-3-1-2-4-8(7)14-6-5-9(13)12-11/h1-4H,5-6,11H2,(H,12,13) |
| InChIKey | GCJNWFUIQXDZQI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|