C11H12FNO4S — CID 63930983
2-[3-(2-fluorophenyl)sulfanylpropanoylamino]oxyacetic acid (PubChem CID 63930983) has the molecular formula C11H12FNO4S and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]oxyacetic acid.
| Compound Name | 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]oxyacetic acid |
|---|---|
| PubChem CID | 63930983 |
| Molecular Formula | C11H12FNO4S |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C11H12FNO4S/c12-8-3-1-2-4-9(8)18-6-5-10(14)13-17-7-11(15)16/h1-4H,5-7H2,(H,13,14)(H,15,16) |
| InChIKey | PDDHRJPTCOKOOE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|