C16H15FN2O2S — CID 26465908
4-[3-(2-fluorophenyl)sulfanylpropanoylamino]benzamide (PubChem CID 26465908) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)sulfanylpropanoylamino]benzamide.
| Compound Name | 4-[3-(2-fluorophenyl)sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 26465908 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-[3-(2-fluorophenyl)sulfanylpropanoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCSc2ccccc2F)cc1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-13-3-1-2-4-14(13)22-10-9-15(20)19-12-7-5-11(6-8-12)16(18)21/h1-8H,9-10H2,(H2,18,21)(H,19,20) |
| InChIKey | HOULTRPTOKOMDE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |