C17H16FNO2S — CID 7964698
N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]propanamide (PubChem CID 7964698) has the molecular formula C17H16FNO2S and a molecular weight of 317.38 g/mol. Its IUPAC name is N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]propanamide.
| Compound Name | N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 7964698 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)CSc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FNO2S/c1-2-17(21)19-13-9-7-12(8-10-13)15(20)11-22-16-6-4-3-5-14(16)18/h3-10H,2,11H2,1H3,(H,19,21) |
| InChIKey | FRTNPBPIRVFZCV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |