C21H16FNO2S — CID 7489443
N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]benzamide (PubChem CID 7489443) has the molecular formula C21H16FNO2S and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7489443 |
| Molecular Formula | C21H16FNO2S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[4-[2-(2-fluorophenyl)sulfanylacetyl]phenyl]benzamide |
| SMILES | O=C(CSc1ccccc1F)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16FNO2S/c22-18-8-4-5-9-20(18)26-14-19(24)15-10-12-17(13-11-15)23-21(25)16-6-2-1-3-7-16/h1-13H,14H2,(H,23,25) |
| InChIKey | LVQVMWGTBYYDPF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |