C22H19NO3S — CID 8673492
N-[4-[2-(4-methoxyphenyl)sulfanylacetyl]phenyl]benzamide (PubChem CID 8673492) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[4-[2-(4-methoxyphenyl)sulfanylacetyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(4-methoxyphenyl)sulfanylacetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 8673492 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[4-[2-(4-methoxyphenyl)sulfanylacetyl]phenyl]benzamide |
| SMILES | COc1ccc(SCC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c1-26-19-11-13-20(14-12-19)27-15-21(24)16-7-9-18(10-8-16)23-22(25)17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,23,25) |
| InChIKey | QHIPTSVYYDQUDP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |