C29H25NO4S — CID 23098281
3,4-dimethoxy-N-[4-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]benzamide (PubChem CID 23098281) has the molecular formula C29H25NO4S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[4-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23098281 |
| Molecular Formula | C29H25NO4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3,4-dimethoxy-N-[4-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(SCC(=O)c3ccc(-c4ccccc4)cc3)cc2)cc1OC |
| InChI | InChI=1S/C29H25NO4S/c1-33-27-17-12-23(18-28(27)34-2)29(32)30-24-13-15-25(16-14-24)35-19-26(31)22-10-8-21(9-11-22)20-6-4-3-5-7-20/h3-18H,19H2,1-2H3,(H,30,32) |
| InChIKey | JEZGFADEPMMYDH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |