C23H22N2O3S — CID 9415706
N-(4-methoxyphenyl)-4-(3-phenylsulfanylpropanoylamino)benzamide (PubChem CID 9415706) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-(3-phenylsulfanylpropanoylamino)benzamide.
| Compound Name | N-(4-methoxyphenyl)-4-(3-phenylsulfanylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 9415706 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(4-methoxyphenyl)-4-(3-phenylsulfanylpropanoylamino)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)CCSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O3S/c1-28-20-13-11-19(12-14-20)25-23(27)17-7-9-18(10-8-17)24-22(26)15-16-29-21-5-3-2-4-6-21/h2-14H,15-16H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | JTWCVXHSXUOIRH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |