C16H16ClNO2S — CID 846817
3-(4-chlorophenyl)sulfanyl-N-(4-methoxyphenyl)propanamide (PubChem CID 846817) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 846817 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClNO2S/c1-20-14-6-4-13(5-7-14)18-16(19)10-11-21-15-8-2-12(17)3-9-15/h2-9H,10-11H2,1H3,(H,18,19) |
| InChIKey | KRNKZBPHQCDWAE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |