C19H22ClNOS — CID 17257472
N-(4-butylphenyl)-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 17257472) has the molecular formula C19H22ClNOS and a molecular weight of 347.91 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-(4-butylphenyl)-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 17257472 |
| Molecular Formula | C19H22ClNOS |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(4-butylphenyl)-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | CCCCc1ccc(NC(=O)CCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H22ClNOS/c1-2-3-4-15-5-9-17(10-6-15)21-19(22)13-14-23-18-11-7-16(20)8-12-18/h5-12H,2-4,13-14H2,1H3,(H,21,22) |
| InChIKey | NRXPBIVJSZBUTF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |