C18H16FNO4S — CID 7676191
[2-(4-acetamidophenyl)-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7676191) has the molecular formula C18H16FNO4S and a molecular weight of 361.39 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7676191 |
| Molecular Formula | C18H16FNO4S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)CSc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H16FNO4S/c1-12(21)20-14-8-6-13(7-9-14)16(22)10-24-18(23)11-25-17-5-3-2-4-15(17)19/h2-9H,10-11H2,1H3,(H,20,21) |
| InChIKey | UFUOEDPYUWCQHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |