C21H22FNO4S — CID 7489309
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7489309) has the molecular formula C21H22FNO4S and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7489309 |
| Molecular Formula | C21H22FNO4S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)CSc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H22FNO4S/c1-15(24)23-12-4-5-16-8-10-17(11-9-16)19(25)13-27-21(26)14-28-20-7-3-2-6-18(20)22/h2-3,6-11H,4-5,12-14H2,1H3,(H,23,24) |
| InChIKey | GWAFEZCCCKPPAU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|