C16H20FNO4 — CID 5186490
[2-(4-fluorophenyl)-2-oxoethyl] 6-acetamidohexanoate (PubChem CID 5186490) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 6-acetamidohexanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 5186490 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO4/c1-12(19)18-10-4-2-3-5-16(21)22-11-15(20)13-6-8-14(17)9-7-13/h6-9H,2-5,10-11H2,1H3,(H,18,19) |
| InChIKey | UQIMCUSEZWTCFU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|