C19H25NO4 — CID 7197417
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-acetamidopropanoate (PubChem CID 7197417) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-acetamidopropanoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-acetamidopropanoate |
|---|---|
| PubChem CID | 7197417 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)OCC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-14(21)20-12-11-19(23)24-13-18(22)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h7-10,15H,2-6,11-13H2,1H3,(H,20,21) |
| InChIKey | JKKPHZZTUBBNBY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |