C20H22O3S — CID 23735027
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 23735027) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 23735027 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)OCC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22O3S/c21-19(13-23-20(22)12-15-10-11-24-14-15)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h6-11,14,16H,1-5,12-13H2 |
| InChIKey | MSPMTIVBVORLQH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |