C33H35NO7 — CID 126006535
4-O-benzyl 1-O-[2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-(phenylmethoxycarbonylamino)butanedioate (PubChem CID 126006535) has the molecular formula C33H35NO7 and a molecular weight of 557.64 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-(phenylmethoxycarbonylamino)butanedioate.
| Compound Name | 4-O-benzyl 1-O-[2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-(phenylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 126006535 |
| Molecular Formula | C33H35NO7 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 4-O-benzyl 1-O-[2-(4-cyclohexylphenyl)-2-oxoethyl] (2R)-2-(phenylmethoxycarbonylamino)butanedioate |
| SMILES | O=C(C[C@@H](NC(=O)OCc1ccccc1)C(=O)OCC(=O)c1ccc(C2CCCCC2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO7/c35-30(28-18-16-27(17-19-28)26-14-8-3-9-15-26)23-40-32(37)29(20-31(36)39-21-24-10-4-1-5-11-24)34-33(38)41-22-25-12-6-2-7-13-25/h1-2,4-7,10-13,16-19,26,29H,3,8-9,14-15,20-23H2,(H,34,38)/t29-/m1/s1 |
| InChIKey | UJFFLUDLUSSVNP-GDLZYMKVSA-N |
| XLogP | 5.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|