C23H27NO3 — CID 57308056
benzyl N-[(2S)-1-cyclohexyl-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 57308056) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is benzyl N-[(2S)-1-cyclohexyl-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-cyclohexyl-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 57308056 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | benzyl N-[(2S)-1-cyclohexyl-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)C1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO3/c25-22(20-14-8-3-9-15-20)21(16-18-10-4-1-5-11-18)24-23(26)27-17-19-12-6-2-7-13-19/h1-2,4-7,10-13,20-21H,3,8-9,14-17H2,(H,24,26)/t21-/m0/s1 |
| InChIKey | VVUIHMLMBPFURV-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |