C27H35N3O3 — CID 67385153
benzyl N-[1-oxo-3-phenyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 67385153) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is benzyl N-[1-oxo-3-phenyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-oxo-3-phenyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 67385153 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | benzyl N-[1-oxo-3-phenyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCC(CN2CCCC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C27H35N3O3/c31-26(30-17-13-23(14-18-30)20-29-15-7-8-16-29)25(19-22-9-3-1-4-10-22)28-27(32)33-21-24-11-5-2-6-12-24/h1-6,9-12,23,25H,7-8,13-21H2,(H,28,32) |
| InChIKey | MQQCBYRQZMONIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |