C26H34N4O4 — CID 46432147
benzyl N-[1-[4-(diethylcarbamoyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 46432147) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is benzyl N-[1-[4-(diethylcarbamoyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[4-(diethylcarbamoyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 46432147 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | benzyl N-[1-[4-(diethylcarbamoyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)C(Cc2ccccc2)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-3-28(4-2)26(33)30-17-15-29(16-18-30)24(31)23(19-21-11-7-5-8-12-21)27-25(32)34-20-22-13-9-6-10-14-22/h5-14,23H,3-4,15-20H2,1-2H3,(H,27,32) |
| InChIKey | QLNUJHDDOWSKDZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |