C22H23FO4 — CID 23855632
[2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 23855632) has the molecular formula C22H23FO4 and a molecular weight of 370.42 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 23855632 |
| Molecular Formula | C22H23FO4 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | O=C(COc1ccccc1F)OCC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H23FO4/c23-19-8-4-5-9-21(19)26-15-22(25)27-14-20(24)18-12-10-17(11-13-18)16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7,14-15H2 |
| InChIKey | KRKLANFQKHETOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |