C10H10FNO3 — CID 144688613
[2-(4-fluorophenyl)-2-oxoethyl] N-methylcarbamate (PubChem CID 144688613) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] N-methylcarbamate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] N-methylcarbamate |
|---|---|
| PubChem CID | 144688613 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] N-methylcarbamate |
| SMILES | CNC(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FNO3/c1-12-10(14)15-6-9(13)7-2-4-8(11)5-3-7/h2-5H,6H2,1H3,(H,12,14) |
| InChIKey | PXBFDEXHDWSFAX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |