C19H17FN2O6 — CID 126006555
[2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-amino-4-oxo-2-(phenoxycarbonylamino)butanoate (PubChem CID 126006555) has the molecular formula C19H17FN2O6 and a molecular weight of 388.35 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-amino-4-oxo-2-(phenoxycarbonylamino)butanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-amino-4-oxo-2-(phenoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 126006555 |
| Molecular Formula | C19H17FN2O6 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-amino-4-oxo-2-(phenoxycarbonylamino)butanoate |
| SMILES | NC(=O)C[C@H](NC(=O)Oc1ccccc1)C(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O6/c20-13-8-6-12(7-9-13)16(23)11-27-18(25)15(10-17(21)24)22-19(26)28-14-4-2-1-3-5-14/h1-9,15H,10-11H2,(H2,21,24)(H,22,26)/t15-/m0/s1 |
| InChIKey | URILHWQLLQRSDF-HNNXBMFYSA-N |
| XLogP | 1.58 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |