C19H18FNO4 — CID 2913195
[2-(4-fluorophenyl)-2-oxoethyl] 2-acetamido-3-phenylpropanoate (PubChem CID 2913195) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-acetamido-3-phenylpropanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 2913195 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO4/c1-13(22)21-17(11-14-5-3-2-4-6-14)19(24)25-12-18(23)15-7-9-16(20)10-8-15/h2-10,17H,11-12H2,1H3,(H,21,22) |
| InChIKey | CAYJCHBHPRYMQX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |