C29H30N2O5 — CID 43030429
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 43030429) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 43030429 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O5/c1-21(32)30-18-8-11-22-14-16-24(17-15-22)27(33)20-36-29(35)26(19-23-9-4-2-5-10-23)31-28(34)25-12-6-3-7-13-25/h2-7,9-10,12-17,26H,8,11,18-20H2,1H3,(H,30,32)(H,31,34) |
| InChIKey | ZWPRYYPEIQPHSD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|