C21H23N3O5 — CID 9491599
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-benzamido-3-phenylpropanoate (PubChem CID 9491599) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-benzamido-3-phenylpropanoate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 9491599 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-benzamido-3-phenylpropanoate |
| SMILES | CNC(=O)CNC(=O)COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O5/c1-22-18(25)13-23-19(26)14-29-21(28)17(12-15-8-4-2-5-9-15)24-20(27)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3,(H,22,25)(H,23,26)(H,24,27)/t17-/m0/s1 |
| InChIKey | AVGGHOGXNZNWSQ-KRWDZBQOSA-N |
| XLogP | 0.43 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |