C26H26N2O4 — CID 2121472
[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (2S)-2-benzamido-3-phenylpropanoate (PubChem CID 2121472) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (2S)-2-benzamido-3-phenylpropanoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (2S)-2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 2121472 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (2S)-2-benzamido-3-phenylpropanoate |
| SMILES | C[C@@H](NC(=O)COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O4/c1-19(21-13-7-3-8-14-21)27-24(29)18-32-26(31)23(17-20-11-5-2-6-12-20)28-25(30)22-15-9-4-10-16-22/h2-16,19,23H,17-18H2,1H3,(H,27,29)(H,28,30)/t19-,23+/m1/s1 |
| InChIKey | XJCMVHOSLOZDTP-XXBNENTESA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |