C19H20N2O4 — CID 2367537
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-benzamidoacetate (PubChem CID 2367537) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-benzamidoacetate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2367537 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-benzamidoacetate |
| SMILES | C[C@H](NC(=O)COC(=O)CNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-14(15-8-4-2-5-9-15)21-17(22)13-25-18(23)12-20-19(24)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,20,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | JTZNSJQQMKOAMG-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |