C19H18ClFN2O4 — CID 8662881
[2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662881) has the molecular formula C19H18ClFN2O4 and a molecular weight of 392.81 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662881 |
| Molecular Formula | C19H18ClFN2O4 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)CNC(=O)c1cccc(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClFN2O4/c1-12(13-5-7-15(20)8-6-13)23-17(24)11-27-18(25)10-22-19(26)14-3-2-4-16(21)9-14/h2-9,12H,10-11H2,1H3,(H,22,26)(H,23,24)/t12-/m1/s1 |
| InChIKey | NHTJFUHBRRSMIK-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |