C13H14FN3O5 — CID 2548358
[2-(methylcarbamoylamino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 2548358) has the molecular formula C13H14FN3O5 and a molecular weight of 311.27 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2548358 |
| Molecular Formula | C13H14FN3O5 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | CNC(=O)NC(=O)COC(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H14FN3O5/c1-15-13(21)17-10(18)7-22-11(19)6-16-12(20)8-3-2-4-9(14)5-8/h2-5H,6-7H2,1H3,(H,16,20)(H2,15,17,18,21) |
| InChIKey | SGORSCHRHJNNFQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |