C17H20FN3O4 — CID 8662599
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662599) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662599 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H20FN3O4/c1-11(2)17(3,10-19)21-14(22)9-25-15(23)8-20-16(24)12-5-4-6-13(18)7-12/h4-7,11H,8-9H2,1-3H3,(H,20,24)(H,21,22)/t17-/m0/s1 |
| InChIKey | YCAHUFDIXGRQTQ-KRWDZBQOSA-N |
| XLogP | 1.15 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |