C18H13ClFN3O4 — CID 8662787
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662787) has the molecular formula C18H13ClFN3O4 and a molecular weight of 389.77 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662787 |
| Molecular Formula | C18H13ClFN3O4 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H13ClFN3O4/c19-13-5-4-12(8-21)15(7-13)23-16(24)10-27-17(25)9-22-18(26)11-2-1-3-14(20)6-11/h1-7H,9-10H2,(H,22,26)(H,23,24) |
| InChIKey | AOGGEFHVRILCKK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |