C16H9Cl2FN2O3 — CID 7826005
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-chloro-4-fluorobenzoate (PubChem CID 7826005) has the molecular formula C16H9Cl2FN2O3 and a molecular weight of 367.16 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-chloro-4-fluorobenzoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 7826005 |
| Molecular Formula | C16H9Cl2FN2O3 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H9Cl2FN2O3/c17-10-2-1-9(7-20)14(5-10)21-15(22)8-24-16(23)12-4-3-11(19)6-13(12)18/h1-6H,8H2,(H,21,22) |
| InChIKey | WJRFCLYKAOATTF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |