C16H11ClN2O3 — CID 2517138
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] benzoate (PubChem CID 2517138) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] benzoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 2517138 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] benzoate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11ClN2O3/c17-13-7-6-12(9-18)14(8-13)19-15(20)10-22-16(21)11-4-2-1-3-5-11/h1-8H,10H2,(H,19,20) |
| InChIKey | DGUASAPTNSVOKJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |