C22H15ClN2O3 — CID 4858479
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-phenylbenzoate (PubChem CID 4858479) has the molecular formula C22H15ClN2O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-phenylbenzoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 4858479 |
| Molecular Formula | C22H15ClN2O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-phenylbenzoate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15ClN2O3/c23-19-11-10-18(13-24)20(12-19)25-21(26)14-28-22(27)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-12H,14H2,(H,25,26) |
| InChIKey | AJIHUHFMGCQWCW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |