C17H11ClN2O4 — CID 2504530
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 2504530) has the molecular formula C17H11ClN2O4 and a molecular weight of 342.74 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504530 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H11ClN2O4/c18-14-6-5-13(8-19)15(7-14)20-16(22)10-24-17(23)12-3-1-11(9-21)2-4-12/h1-7,9H,10H2,(H,20,22) |
| InChIKey | OZEWMNDGXTVOSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|