C17H12N2O4 — CID 2504512
[2-(2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 2504512) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504512 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H12N2O4/c18-9-14-3-1-2-4-15(14)19-16(21)11-23-17(22)13-7-5-12(10-20)6-8-13/h1-8,10H,11H2,(H,19,21) |
| InChIKey | HPBYFVPOPPZVAD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|