C27H18N2O5 — CID 23876644
[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 23876644) has the molecular formula C27H18N2O5 and a molecular weight of 450.45 g/mol. Its IUPAC name is [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 23876644 |
| Molecular Formula | C27H18N2O5 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | N#Cc1c(NC(=O)COC(=O)c2ccc(C=O)cc2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H18N2O5/c28-15-22-24(19-7-3-1-4-8-19)25(20-9-5-2-6-10-20)34-26(22)29-23(31)17-33-27(32)21-13-11-18(16-30)12-14-21/h1-14,16H,17H2,(H,29,31) |
| InChIKey | DMDFTMBCHGSFNO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|