C19H13ClN2O2 — CID 3550941
2-chloro-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide (PubChem CID 3550941) has the molecular formula C19H13ClN2O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide.
| Compound Name | 2-chloro-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 3550941 |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CCl)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H13ClN2O2/c20-11-16(23)22-19-15(12-21)17(13-7-3-1-4-8-13)18(24-19)14-9-5-2-6-10-14/h1-10H,11H2,(H,22,23) |
| InChIKey | CAMPPHMZHCCAFA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|