C20H15BrN2O2 — CID 108757660
2-bromo-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide (PubChem CID 108757660) has the molecular formula C20H15BrN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 2-bromo-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide.
| Compound Name | 2-bromo-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 108757660 |
| Molecular Formula | C20H15BrN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-bromo-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide |
| SMILES | CC(Br)C(=O)Nc1oc(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C20H15BrN2O2/c1-13(21)19(24)23-20-16(12-22)17(14-8-4-2-5-9-14)18(25-20)15-10-6-3-7-11-15/h2-11,13H,1H3,(H,23,24) |
| InChIKey | QBZTVFZCNGUWEO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|