C18H14N2O3S — CID 108781743
N-(3-cyano-4,5-diphenylfuran-2-yl)methanesulfonamide (PubChem CID 108781743) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)methanesulfonamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 108781743 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1oc(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C18H14N2O3S/c1-24(21,22)20-18-15(12-19)16(13-8-4-2-5-9-13)17(23-18)14-10-6-3-7-11-14/h2-11,20H,1H3 |
| InChIKey | CGOGMOASIKCSOD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |