C24H17FN2O — CID 155812020
2-[(4-fluorophenyl)methylamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 155812020) has the molecular formula C24H17FN2O and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(4-fluorophenyl)methylamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 155812020 |
| Molecular Formula | C24H17FN2O |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methylamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | N#Cc1c(NCc2ccc(F)cc2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H17FN2O/c25-20-13-11-17(12-14-20)16-27-24-21(15-26)22(18-7-3-1-4-8-18)23(28-24)19-9-5-2-6-10-19/h1-14,27H,16H2 |
| InChIKey | HVVPALWZTSORAG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |