C25H18N2O2 — CID 108757664
N-(3-cyano-4,5-diphenylfuran-2-yl)-4-methylbenzamide (PubChem CID 108757664) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-4-methylbenzamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 108757664 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C25H18N2O2/c1-17-12-14-20(15-13-17)24(28)27-25-21(16-26)22(18-8-4-2-5-9-18)23(29-25)19-10-6-3-7-11-19/h2-15H,1H3,(H,27,28) |
| InChIKey | IQCOVBQXPOSBDQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |