C32H23N3O2 — CID 23941523
N-[3-[(3-cyano-4,5-diphenylfuran-2-yl)iminomethyl]phenyl]-4-methylbenzamide (PubChem CID 23941523) has the molecular formula C32H23N3O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[3-[(3-cyano-4,5-diphenylfuran-2-yl)iminomethyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[(3-cyano-4,5-diphenylfuran-2-yl)iminomethyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 23941523 |
| Molecular Formula | C32H23N3O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[3-[(3-cyano-4,5-diphenylfuran-2-yl)iminomethyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C=Nc3oc(-c4ccccc4)c(-c4ccccc4)c3C#N)c2)cc1 |
| InChI | InChI=1S/C32H23N3O2/c1-22-15-17-26(18-16-22)31(36)35-27-14-8-9-23(19-27)21-34-32-28(20-33)29(24-10-4-2-5-11-24)30(37-32)25-12-6-3-7-13-25/h2-19,21H,1H3,(H,35,36) |
| InChIKey | YMZQBCBFBJPZHQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|