C21H19N3O3S — CID 6910126
N-[3-[(E)-(benzenesulfonylhydrazinylidene)methyl]phenyl]-4-methylbenzamide (PubChem CID 6910126) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[3-[(E)-(benzenesulfonylhydrazinylidene)methyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[(E)-(benzenesulfonylhydrazinylidene)methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 6910126 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[3-[(E)-(benzenesulfonylhydrazinylidene)methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(/C=N/NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-16-10-12-18(13-11-16)21(25)23-19-7-5-6-17(14-19)15-22-24-28(26,27)20-8-3-2-4-9-20/h2-15,24H,1H3,(H,23,25)/b22-15+ |
| InChIKey | XAUAOQKMIBTPGA-PXLXIMEGSA-N |
| XLogP | 3.56 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|