C28H20N4O2 — CID 108757752
N-(3-cyano-4,5-diphenylfuran-2-yl)-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 108757752) has the molecular formula C28H20N4O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108757752 |
| Molecular Formula | C28H20N4O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3oc(-c4ccccc4)c(-c4ccccc4)c3C#N)cc2nc1C |
| InChI | InChI=1S/C28H20N4O2/c1-17-18(2)31-24-15-21(13-14-23(24)30-17)27(33)32-28-22(16-29)25(19-9-5-3-6-10-19)26(34-28)20-11-7-4-8-12-20/h3-15H,1-2H3,(H,32,33) |
| InChIKey | FMFHEBRRNZSUAW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |