C24H14N4O6 — CID 23875644
N-(3-cyano-4,5-diphenylfuran-2-yl)-2,4-dinitrobenzamide (PubChem CID 23875644) has the molecular formula C24H14N4O6 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2,4-dinitrobenzamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 23875644 |
| Molecular Formula | C24H14N4O6 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,4-dinitrobenzamide |
| SMILES | N#Cc1c(NC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H14N4O6/c25-14-19-21(15-7-3-1-4-8-15)22(16-9-5-2-6-10-16)34-24(19)26-23(29)18-12-11-17(27(30)31)13-20(18)28(32)33/h1-13H,(H,26,29) |
| InChIKey | UJLREJPXNWLRAM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|