C13H8BrN3O5 — CID 4244481
N-(2-bromophenyl)-2,4-dinitrobenzamide (PubChem CID 4244481) has the molecular formula C13H8BrN3O5 and a molecular weight of 366.13 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,4-dinitrobenzamide.
| Compound Name | N-(2-bromophenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 4244481 |
| Molecular Formula | C13H8BrN3O5 |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | N-(2-bromophenyl)-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccccc1Br)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8BrN3O5/c14-10-3-1-2-4-11(10)15-13(18)9-6-5-8(16(19)20)7-12(9)17(21)22/h1-7H,(H,15,18) |
| InChIKey | ASMDYMSPGKJMKQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|