C20H11BrClN3O6 — CID 23769969
N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2,4-dinitrobenzamide (PubChem CID 23769969) has the molecular formula C20H11BrClN3O6 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 23769969 |
| Molecular Formula | C20H11BrClN3O6 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 502.95 |
| IUPAC Name | N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2,4-dinitrobenzamide |
| SMILES | O=C(c1ccccc1Cl)c1cc(Br)ccc1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H11BrClN3O6/c21-11-5-8-17(15(9-11)19(26)13-3-1-2-4-16(13)22)23-20(27)14-7-6-12(24(28)29)10-18(14)25(30)31/h1-10H,(H,23,27) |
| InChIKey | CJECXZJWNTTZOQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|