C13H7BrFN3O5 — CID 3306901
N-(4-bromo-2-fluorophenyl)-2,4-dinitrobenzamide (PubChem CID 3306901) has the molecular formula C13H7BrFN3O5 and a molecular weight of 384.12 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2,4-dinitrobenzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3306901 |
| Molecular Formula | C13H7BrFN3O5 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H7BrFN3O5/c14-7-1-4-11(10(15)5-7)16-13(19)9-3-2-8(17(20)21)6-12(9)18(22)23/h1-6H,(H,16,19) |
| InChIKey | WPCJMQLDOCTQHG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|